[4-(3-chlorophenyl)piperazin-1-yl][1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone
Chemical Structure Depiction of
[4-(3-chlorophenyl)piperazin-1-yl][1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone
[4-(3-chlorophenyl)piperazin-1-yl][1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone
Compound characteristics
| Compound ID: | D522-0061 |
| Compound Name: | [4-(3-chlorophenyl)piperazin-1-yl][1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone |
| Molecular Weight: | 372.78 |
| Molecular Formula: | C16 H16 Cl F3 N4 O |
| Smiles: | [H]c1c(C(N2CCN(CC2)c2cccc(c2)[Cl])=O)nn(C)c1C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 2.9146 |
| logD: | 2.9146 |
| logSw: | -3.3132 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 33.663 |
| InChI Key: | QDIYMCGUGYHWFO-UHFFFAOYSA-N |