4-(3-chlorophenyl)-3,7,7-trimethyl-4,7,8,9-tetrahydro[1,2]oxazolo[5,4-b]quinolin-5(6H)-one
Chemical Structure Depiction of
4-(3-chlorophenyl)-3,7,7-trimethyl-4,7,8,9-tetrahydro[1,2]oxazolo[5,4-b]quinolin-5(6H)-one
4-(3-chlorophenyl)-3,7,7-trimethyl-4,7,8,9-tetrahydro[1,2]oxazolo[5,4-b]quinolin-5(6H)-one
Compound characteristics
| Compound ID: | D526-0055 |
| Compound Name: | 4-(3-chlorophenyl)-3,7,7-trimethyl-4,7,8,9-tetrahydro[1,2]oxazolo[5,4-b]quinolin-5(6H)-one |
| Molecular Weight: | 342.82 |
| Molecular Formula: | C19 H19 Cl N2 O2 |
| Smiles: | Cc1c2C(C3=C(CC(C)(C)CC3=O)Nc2on1)c1cccc(c1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0003 |
| logD: | 1.8168 |
| logSw: | -4.3714 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.711 |
| InChI Key: | WEDSPTUXKVAVTR-MRXNPFEDSA-N |