N-(2,4-difluorophenyl)-1,1-dioxo-3-[(prop-2-en-1-yl)amino]-1H-1-benzothiophene-2-carboxamide
Chemical Structure Depiction of
N-(2,4-difluorophenyl)-1,1-dioxo-3-[(prop-2-en-1-yl)amino]-1H-1-benzothiophene-2-carboxamide
N-(2,4-difluorophenyl)-1,1-dioxo-3-[(prop-2-en-1-yl)amino]-1H-1-benzothiophene-2-carboxamide
Compound characteristics
| Compound ID: | D531-0632 |
| Compound Name: | N-(2,4-difluorophenyl)-1,1-dioxo-3-[(prop-2-en-1-yl)amino]-1H-1-benzothiophene-2-carboxamide |
| Molecular Weight: | 376.38 |
| Molecular Formula: | C18 H14 F2 N2 O3 S |
| Smiles: | C=CCNC1=C(C(Nc2ccc(cc2F)F)=O)S(c2ccccc12)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4181 |
| logD: | 2.3681 |
| logSw: | -3.0662 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.445 |
| InChI Key: | NOEMCMPTFBCZKS-UHFFFAOYSA-N |