N-[(4-fluorophenyl)methyl]-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide
N-[(4-fluorophenyl)methyl]-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide
Compound characteristics
| Compound ID: | D537-0522 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide |
| Molecular Weight: | 422.5 |
| Molecular Formula: | C24 H27 F N4 O2 |
| Smiles: | CCCOc1c(nc2ccccc2n1)N1CCCC(C1)C(NCc1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4669 |
| logD: | 4.4669 |
| logSw: | -4.1222 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.079 |
| InChI Key: | AHYYPTZZZQRKNP-SFHVURJKSA-N |