N-[5-(ethylsulfanyl)-1,3,4-thiadiazol-2-yl]-8-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
Chemical Structure Depiction of
N-[5-(ethylsulfanyl)-1,3,4-thiadiazol-2-yl]-8-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
N-[5-(ethylsulfanyl)-1,3,4-thiadiazol-2-yl]-8-methyl-4-oxo-4H-1-benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | D538-0193 |
| Compound Name: | N-[5-(ethylsulfanyl)-1,3,4-thiadiazol-2-yl]-8-methyl-4-oxo-4H-1-benzopyran-2-carboxamide |
| Molecular Weight: | 347.41 |
| Molecular Formula: | C15 H13 N3 O3 S2 |
| Smiles: | [H]N(C(C1=CC(c2cccc(C)c2O1)=O)=O)c1nnc(SCC)s1 |
| Stereo: | ACHIRAL |
| logP: | 4.0366 |
| logD: | 4.0027 |
| logSw: | -4.2583 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.738 |
| InChI Key: | PCRYZNIVKSIIAS-UHFFFAOYSA-N |