2-[5-(benzylsulfanyl)-4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl]thieno[2,3-b]pyridin-3-amine
Chemical Structure Depiction of
2-[5-(benzylsulfanyl)-4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl]thieno[2,3-b]pyridin-3-amine
2-[5-(benzylsulfanyl)-4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl]thieno[2,3-b]pyridin-3-amine
Compound characteristics
| Compound ID: | D549-2017 |
| Compound Name: | 2-[5-(benzylsulfanyl)-4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl]thieno[2,3-b]pyridin-3-amine |
| Molecular Weight: | 397.52 |
| Molecular Formula: | C19 H19 N5 O S2 |
| Smiles: | COCCn1c(c2c(c3cccnc3s2)N)nnc1SCc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.1678 |
| logD: | 3.1662 |
| logSw: | -3.0263 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.1 |
| InChI Key: | VROZINRJOLRRCI-UHFFFAOYSA-N |