2-({5-(3-aminothieno[2,3-b]pyridin-2-yl)-4-[(oxolan-2-yl)methyl]-4H-1,2,4-triazol-3-yl}sulfanyl)-N-(2,5-dimethylphenyl)acetamide
Chemical Structure Depiction of
2-({5-(3-aminothieno[2,3-b]pyridin-2-yl)-4-[(oxolan-2-yl)methyl]-4H-1,2,4-triazol-3-yl}sulfanyl)-N-(2,5-dimethylphenyl)acetamide
2-({5-(3-aminothieno[2,3-b]pyridin-2-yl)-4-[(oxolan-2-yl)methyl]-4H-1,2,4-triazol-3-yl}sulfanyl)-N-(2,5-dimethylphenyl)acetamide
Compound characteristics
| Compound ID: | D549-2531 |
| Compound Name: | 2-({5-(3-aminothieno[2,3-b]pyridin-2-yl)-4-[(oxolan-2-yl)methyl]-4H-1,2,4-triazol-3-yl}sulfanyl)-N-(2,5-dimethylphenyl)acetamide |
| Molecular Weight: | 494.64 |
| Molecular Formula: | C24 H26 N6 O2 S2 |
| Smiles: | Cc1ccc(C)c(c1)NC(CSc1nnc(c2c(c3cccnc3s2)N)n1CC1CCCO1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.0558 |
| logD: | 3.0542 |
| logSw: | -3.0601 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 84.614 |
| InChI Key: | LOLLTXVQKJGVPK-MRXNPFEDSA-N |