2-{5-[(2,5-dimethylphenoxy)methyl]furan-2-yl}-5-(morpholin-4-yl)-1,3-oxazole-4-carbonitrile
Chemical Structure Depiction of
2-{5-[(2,5-dimethylphenoxy)methyl]furan-2-yl}-5-(morpholin-4-yl)-1,3-oxazole-4-carbonitrile
2-{5-[(2,5-dimethylphenoxy)methyl]furan-2-yl}-5-(morpholin-4-yl)-1,3-oxazole-4-carbonitrile
Compound characteristics
| Compound ID: | D561-0838 |
| Compound Name: | 2-{5-[(2,5-dimethylphenoxy)methyl]furan-2-yl}-5-(morpholin-4-yl)-1,3-oxazole-4-carbonitrile |
| Molecular Weight: | 379.41 |
| Molecular Formula: | C21 H21 N3 O4 |
| Smiles: | Cc1ccc(C)c(c1)OCc1ccc(c2nc(C#N)c(N3CCOCC3)o2)o1 |
| Stereo: | ACHIRAL |
| logP: | 4.0535 |
| logD: | 4.0535 |
| logSw: | -4.061 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 62.819 |
| InChI Key: | DFFCWHZRANWHKA-UHFFFAOYSA-N |