3-(4-chlorophenyl)-7-(2-methylphenyl)-5-oxo-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid
Chemical Structure Depiction of
3-(4-chlorophenyl)-7-(2-methylphenyl)-5-oxo-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid
3-(4-chlorophenyl)-7-(2-methylphenyl)-5-oxo-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid
Compound characteristics
| Compound ID: | D562-0118 |
| Compound Name: | 3-(4-chlorophenyl)-7-(2-methylphenyl)-5-oxo-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid |
| Molecular Weight: | 397.88 |
| Molecular Formula: | C21 H16 Cl N O3 S |
| Smiles: | Cc1ccccc1C1CC(Nc2c(c3ccc(cc3)[Cl])c(C(O)=O)sc12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6096 |
| logD: | 2.8095 |
| logSw: | -4.7212 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.691 |
| InChI Key: | YXKDCMMTYVFZHB-HNNXBMFYSA-N |