3-(4-methoxyphenyl)-5-oxo-7-(3-propoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid
Chemical Structure Depiction of
3-(4-methoxyphenyl)-5-oxo-7-(3-propoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid
3-(4-methoxyphenyl)-5-oxo-7-(3-propoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid
Compound characteristics
| Compound ID: | D562-0555 |
| Compound Name: | 3-(4-methoxyphenyl)-5-oxo-7-(3-propoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid |
| Molecular Weight: | 437.51 |
| Molecular Formula: | C24 H23 N O5 S |
| Smiles: | CCCOc1cccc(c1)C1CC(Nc2c(c3ccc(cc3)OC)c(C(O)=O)sc12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5644 |
| logD: | 2.7644 |
| logSw: | -4.4243 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.652 |
| InChI Key: | LOLIUGKVKNAMJJ-GOSISDBHSA-N |