7-[3-(2-amino-2-oxoethoxy)phenyl]-3-(3-fluorophenyl)-5-oxo-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid
Chemical Structure Depiction of
7-[3-(2-amino-2-oxoethoxy)phenyl]-3-(3-fluorophenyl)-5-oxo-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid
7-[3-(2-amino-2-oxoethoxy)phenyl]-3-(3-fluorophenyl)-5-oxo-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid
Compound characteristics
| Compound ID: | D562-1025 |
| Compound Name: | 7-[3-(2-amino-2-oxoethoxy)phenyl]-3-(3-fluorophenyl)-5-oxo-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid |
| Molecular Weight: | 440.45 |
| Molecular Formula: | C22 H17 F N2 O5 S |
| Smiles: | C1C(c2cccc(c2)OCC(N)=O)c2c(c(c3cccc(c3)F)c(C(O)=O)s2)NC1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.9795 |
| logD: | 0.1795 |
| logSw: | -2.7355 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 92.578 |
| InChI Key: | BPTWVLLMZJCHHP-OAHLLOKOSA-N |