3-chloro-N-(4-{[6-(diethylamino)-2-methylpyrimidin-4-yl]amino}phenyl)benzene-1-sulfonamide
Chemical Structure Depiction of
3-chloro-N-(4-{[6-(diethylamino)-2-methylpyrimidin-4-yl]amino}phenyl)benzene-1-sulfonamide
3-chloro-N-(4-{[6-(diethylamino)-2-methylpyrimidin-4-yl]amino}phenyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | D571-0026 |
| Compound Name: | 3-chloro-N-(4-{[6-(diethylamino)-2-methylpyrimidin-4-yl]amino}phenyl)benzene-1-sulfonamide |
| Molecular Weight: | 445.97 |
| Molecular Formula: | C21 H24 Cl N5 O2 S |
| Smiles: | CCN(CC)c1cc(Nc2ccc(cc2)NS(c2cccc(c2)[Cl])(=O)=O)nc(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.2153 |
| logD: | 3.922 |
| logSw: | -5.606 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.751 |
| InChI Key: | KRQJZRIKKHJWPB-UHFFFAOYSA-N |