5-bromo-N-(4-{[2-(ethylamino)-6-methylpyrimidin-4-yl]amino}phenyl)furan-2-carboxamide
Chemical Structure Depiction of
5-bromo-N-(4-{[2-(ethylamino)-6-methylpyrimidin-4-yl]amino}phenyl)furan-2-carboxamide
5-bromo-N-(4-{[2-(ethylamino)-6-methylpyrimidin-4-yl]amino}phenyl)furan-2-carboxamide
Compound characteristics
| Compound ID: | D576-0053 |
| Compound Name: | 5-bromo-N-(4-{[2-(ethylamino)-6-methylpyrimidin-4-yl]amino}phenyl)furan-2-carboxamide |
| Molecular Weight: | 416.28 |
| Molecular Formula: | C18 H18 Br N5 O2 |
| Smiles: | CCNc1nc(C)cc(Nc2ccc(cc2)NC(c2ccc(o2)[Br])=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.2319 |
| logD: | 3.1489 |
| logSw: | -4.1821 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 71.379 |
| InChI Key: | VPSLPDPCTQWFFO-UHFFFAOYSA-N |