N-(4-{[2-(ethylamino)-6-methylpyrimidin-4-yl]amino}phenyl)-4-(trifluoromethyl)benzene-1-sulfonamide
Chemical Structure Depiction of
N-(4-{[2-(ethylamino)-6-methylpyrimidin-4-yl]amino}phenyl)-4-(trifluoromethyl)benzene-1-sulfonamide
N-(4-{[2-(ethylamino)-6-methylpyrimidin-4-yl]amino}phenyl)-4-(trifluoromethyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | D578-0032 |
| Compound Name: | N-(4-{[2-(ethylamino)-6-methylpyrimidin-4-yl]amino}phenyl)-4-(trifluoromethyl)benzene-1-sulfonamide |
| Molecular Weight: | 451.47 |
| Molecular Formula: | C20 H20 F3 N5 O2 S |
| Smiles: | CCNc1nc(C)cc(Nc2ccc(cc2)NS(c2ccc(cc2)C(F)(F)F)(=O)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.9126 |
| logD: | 3.8296 |
| logSw: | -4.6533 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 80.011 |
| InChI Key: | BPWKCGBJJXCGJA-UHFFFAOYSA-N |