2,4,6-trimethyl-N-(4-{[6-methyl-2-(piperidin-1-yl)pyrimidin-4-yl]amino}phenyl)benzene-1-sulfonamide
Chemical Structure Depiction of
2,4,6-trimethyl-N-(4-{[6-methyl-2-(piperidin-1-yl)pyrimidin-4-yl]amino}phenyl)benzene-1-sulfonamide
2,4,6-trimethyl-N-(4-{[6-methyl-2-(piperidin-1-yl)pyrimidin-4-yl]amino}phenyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | D578-0240 |
| Compound Name: | 2,4,6-trimethyl-N-(4-{[6-methyl-2-(piperidin-1-yl)pyrimidin-4-yl]amino}phenyl)benzene-1-sulfonamide |
| Molecular Weight: | 465.62 |
| Molecular Formula: | C25 H31 N5 O2 S |
| Smiles: | Cc1cc(C)c(c(C)c1)S(Nc1ccc(cc1)Nc1cc(C)nc(n1)N1CCCCC1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.5291 |
| logD: | 5.91 |
| logSw: | -5.5813 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.125 |
| InChI Key: | AQZBRWMOLQFEAS-UHFFFAOYSA-N |