N-(4-ethoxyphenyl)-2-[(6-hydroxy-9H-purin-2-yl)sulfanyl]acetamide
					Chemical Structure Depiction of
N-(4-ethoxyphenyl)-2-[(6-hydroxy-9H-purin-2-yl)sulfanyl]acetamide
			N-(4-ethoxyphenyl)-2-[(6-hydroxy-9H-purin-2-yl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | D585-0006 | 
| Compound Name: | N-(4-ethoxyphenyl)-2-[(6-hydroxy-9H-purin-2-yl)sulfanyl]acetamide | 
| Molecular Weight: | 345.38 | 
| Molecular Formula: | C15 H15 N5 O3 S | 
| Smiles: | CCOc1ccc(cc1)NC(CSc1nc(c2c(n1)[nH]cn2)O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 1.4896 | 
| logD: | 0.9502 | 
| logSw: | -2.3209 | 
| Hydrogen bond acceptors count: | 8 | 
| Hydrogen bond donors count: | 3 | 
| Polar surface area: | 87.12 | 
| InChI Key: | SFAJCKROQQHWLV-UHFFFAOYSA-N | 
 
				 
				