N-(2,4-dimethylphenyl)-3-[5-(3,4-dimethylphenyl)furan-2-yl]propanamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-3-[5-(3,4-dimethylphenyl)furan-2-yl]propanamide
N-(2,4-dimethylphenyl)-3-[5-(3,4-dimethylphenyl)furan-2-yl]propanamide
Compound characteristics
| Compound ID: | D586-0089 |
| Compound Name: | N-(2,4-dimethylphenyl)-3-[5-(3,4-dimethylphenyl)furan-2-yl]propanamide |
| Molecular Weight: | 347.46 |
| Molecular Formula: | C23 H25 N O2 |
| Smiles: | Cc1ccc(c(C)c1)NC(CCc1ccc(c2ccc(C)c(C)c2)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.72 |
| logD: | 5.72 |
| logSw: | -5.3125 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.9882 |
| InChI Key: | BTTWYQXBAVTZPE-UHFFFAOYSA-N |