N-(3,5-dimethylphenyl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]acetamide
Chemical Structure Depiction of
N-(3,5-dimethylphenyl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]acetamide
N-(3,5-dimethylphenyl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]acetamide
Compound characteristics
| Compound ID: | D629-0085 |
| Compound Name: | N-(3,5-dimethylphenyl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]acetamide |
| Molecular Weight: | 352.45 |
| Molecular Formula: | C20 H20 N2 O2 S |
| Smiles: | Cc1cc(C)cc(c1)NC(Cc1csc(COc2ccccc2)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6174 |
| logD: | 4.6174 |
| logSw: | -4.3825 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.34 |
| InChI Key: | QPPNTIUIRRXTPN-UHFFFAOYSA-N |