N-(4-methoxyphenyl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]acetamide
Chemical Structure Depiction of
N-(4-methoxyphenyl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]acetamide
N-(4-methoxyphenyl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]acetamide
Compound characteristics
| Compound ID: | D629-0099 |
| Compound Name: | N-(4-methoxyphenyl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]acetamide |
| Molecular Weight: | 354.43 |
| Molecular Formula: | C19 H18 N2 O3 S |
| Smiles: | COc1ccc(cc1)NC(Cc1csc(COc2ccccc2)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9068 |
| logD: | 3.9068 |
| logSw: | -4.1 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.884 |
| InChI Key: | GADJHOPWTRLDJC-UHFFFAOYSA-N |