N-(4-ethoxyphenyl)-2-{2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl}acetamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-2-{2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl}acetamide
N-(4-ethoxyphenyl)-2-{2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl}acetamide
Compound characteristics
| Compound ID: | D629-0220 |
| Compound Name: | N-(4-ethoxyphenyl)-2-{2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl}acetamide |
| Molecular Weight: | 382.48 |
| Molecular Formula: | C21 H22 N2 O3 S |
| Smiles: | CCOc1ccc(cc1)NC(Cc1csc(COc2ccc(C)cc2)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7453 |
| logD: | 4.7453 |
| logSw: | -4.4075 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.463 |
| InChI Key: | VBFFKCIXQSMPPY-UHFFFAOYSA-N |