N-[2-(4-fluorophenyl)-2-(thiophene-2-sulfonyl)ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide
Chemical Structure Depiction of
N-[2-(4-fluorophenyl)-2-(thiophene-2-sulfonyl)ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide
N-[2-(4-fluorophenyl)-2-(thiophene-2-sulfonyl)ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide
Compound characteristics
| Compound ID: | D630-0068 |
| Compound Name: | N-[2-(4-fluorophenyl)-2-(thiophene-2-sulfonyl)ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
| Molecular Weight: | 479.61 |
| Molecular Formula: | C22 H22 F N O4 S3 |
| Smiles: | C1CCc2cc(ccc2C1)S(NCC(c1ccc(cc1)F)S(c1cccs1)(=O)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9359 |
| logD: | 4.9358 |
| logSw: | -4.9585 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.437 |
| InChI Key: | DZTOKNVGBZNRPA-NRFANRHFSA-N |