3-chloro-N-[2-(4-fluorophenyl)-2-(thiophene-2-sulfonyl)ethyl]-4-methoxybenzene-1-sulfonamide
Chemical Structure Depiction of
3-chloro-N-[2-(4-fluorophenyl)-2-(thiophene-2-sulfonyl)ethyl]-4-methoxybenzene-1-sulfonamide
3-chloro-N-[2-(4-fluorophenyl)-2-(thiophene-2-sulfonyl)ethyl]-4-methoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | D630-0086 |
| Compound Name: | 3-chloro-N-[2-(4-fluorophenyl)-2-(thiophene-2-sulfonyl)ethyl]-4-methoxybenzene-1-sulfonamide |
| Molecular Weight: | 489.99 |
| Molecular Formula: | C19 H17 Cl F N O5 S3 |
| Smiles: | COc1ccc(cc1[Cl])S(NCC(c1ccc(cc1)F)S(c1cccs1)(=O)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8712 |
| logD: | 3.8711 |
| logSw: | -4.306 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.146 |
| InChI Key: | XFOJYDQILDJYHD-SFHVURJKSA-N |