2-chloro-3-hydroxy-4-[(3-methylpiperidin-1-yl)methyl]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
Chemical Structure Depiction of
2-chloro-3-hydroxy-4-[(3-methylpiperidin-1-yl)methyl]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
2-chloro-3-hydroxy-4-[(3-methylpiperidin-1-yl)methyl]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
Compound characteristics
| Compound ID: | D635-0050 |
| Compound Name: | 2-chloro-3-hydroxy-4-[(3-methylpiperidin-1-yl)methyl]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one |
| Molecular Weight: | 361.87 |
| Molecular Formula: | C20 H24 Cl N O3 |
| Smiles: | CC1CCCN(C1)Cc1c(c(cc2C3CCCCC=3C(=O)Oc12)[Cl])O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0687 |
| logD: | 4.4604 |
| logSw: | -4.9376 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.91 |
| InChI Key: | UUEGAQAXSCEANP-LBPRGKRZSA-N |