4-butyl-8-[(dimethylamino)methyl]-7-hydroxy-2H-1-benzopyran-2-one
Chemical Structure Depiction of
4-butyl-8-[(dimethylamino)methyl]-7-hydroxy-2H-1-benzopyran-2-one
4-butyl-8-[(dimethylamino)methyl]-7-hydroxy-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | D635-0130 |
| Compound Name: | 4-butyl-8-[(dimethylamino)methyl]-7-hydroxy-2H-1-benzopyran-2-one |
| Molecular Weight: | 275.35 |
| Molecular Formula: | C16 H21 N O3 |
| Smiles: | CCCCC1=CC(=O)Oc2c1ccc(c2CN(C)C)O |
| Stereo: | ACHIRAL |
| logP: | 2.954 |
| logD: | 2.1773 |
| logSw: | -3.2839 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.765 |
| InChI Key: | MUSUVMDVWQVBIN-UHFFFAOYSA-N |