N-(2-ethoxyphenyl)-4-{3-[(2-methylphenyl)methyl]-2-oxo-1,3-diazinan-1-yl}benzamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-4-{3-[(2-methylphenyl)methyl]-2-oxo-1,3-diazinan-1-yl}benzamide
N-(2-ethoxyphenyl)-4-{3-[(2-methylphenyl)methyl]-2-oxo-1,3-diazinan-1-yl}benzamide
Compound characteristics
| Compound ID: | D642-0007 |
| Compound Name: | N-(2-ethoxyphenyl)-4-{3-[(2-methylphenyl)methyl]-2-oxo-1,3-diazinan-1-yl}benzamide |
| Molecular Weight: | 443.55 |
| Molecular Formula: | C27 H29 N3 O3 |
| Smiles: | CCOc1ccccc1NC(c1ccc(cc1)N1CCCN(Cc2ccccc2C)C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5253 |
| logD: | 5.5225 |
| logSw: | -5.3525 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.401 |
| InChI Key: | CGAYCZYDCSKEOQ-UHFFFAOYSA-N |