4-{3-[(4-chlorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl}-N-[(furan-2-yl)methyl]benzamide
Chemical Structure Depiction of
4-{3-[(4-chlorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl}-N-[(furan-2-yl)methyl]benzamide
4-{3-[(4-chlorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl}-N-[(furan-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | D642-0115 |
| Compound Name: | 4-{3-[(4-chlorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl}-N-[(furan-2-yl)methyl]benzamide |
| Molecular Weight: | 423.9 |
| Molecular Formula: | C23 H22 Cl N3 O3 |
| Smiles: | C1CN(Cc2ccc(cc2)[Cl])C(N(C1)c1ccc(cc1)C(NCc1ccco1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2593 |
| logD: | 4.2592 |
| logSw: | -4.6187 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.959 |
| InChI Key: | OYIWKLSELYZJSL-UHFFFAOYSA-N |