2-(2,3-dimethylphenoxy)-N-[5-(4-ethoxyphenyl)-1,2,4-oxadiazol-3-yl]propanamide
Chemical Structure Depiction of
2-(2,3-dimethylphenoxy)-N-[5-(4-ethoxyphenyl)-1,2,4-oxadiazol-3-yl]propanamide
2-(2,3-dimethylphenoxy)-N-[5-(4-ethoxyphenyl)-1,2,4-oxadiazol-3-yl]propanamide
Compound characteristics
| Compound ID: | D646-0161 |
| Compound Name: | 2-(2,3-dimethylphenoxy)-N-[5-(4-ethoxyphenyl)-1,2,4-oxadiazol-3-yl]propanamide |
| Molecular Weight: | 381.43 |
| Molecular Formula: | C21 H23 N3 O4 |
| Smiles: | [H]N(C(C(C)Oc1cccc(C)c1C)=O)c1nc(c2ccc(cc2)OCC)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0182 |
| logD: | 5.0175 |
| logSw: | -4.4549 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.141 |
| InChI Key: | NUFOSPKMLMIPAE-HNNXBMFYSA-N |