2-chlorophenyl 5-chloro-2-[(4-methylphenyl)methanesulfonyl]pyrimidine-4-carboxylate
Chemical Structure Depiction of
2-chlorophenyl 5-chloro-2-[(4-methylphenyl)methanesulfonyl]pyrimidine-4-carboxylate
2-chlorophenyl 5-chloro-2-[(4-methylphenyl)methanesulfonyl]pyrimidine-4-carboxylate
Compound characteristics
| Compound ID: | D650-0098 |
| Compound Name: | 2-chlorophenyl 5-chloro-2-[(4-methylphenyl)methanesulfonyl]pyrimidine-4-carboxylate |
| Molecular Weight: | 437.3 |
| Molecular Formula: | C19 H14 Cl2 N2 O4 S |
| Smiles: | Cc1ccc(CS(c2ncc(c(C(=O)Oc3ccccc3[Cl])n2)[Cl])(=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.2646 |
| logD: | 4.2646 |
| logSw: | -4.419 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 68.881 |
| InChI Key: | MZMAMSKBKLAXEC-UHFFFAOYSA-N |