7-chloro-2-[3-(dimethylamino)propyl]-1-(4-ethoxy-3-methoxyphenyl)-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Chemical Structure Depiction of
7-chloro-2-[3-(dimethylamino)propyl]-1-(4-ethoxy-3-methoxyphenyl)-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
7-chloro-2-[3-(dimethylamino)propyl]-1-(4-ethoxy-3-methoxyphenyl)-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Compound characteristics
| Compound ID: | D658-0142 |
| Compound Name: | 7-chloro-2-[3-(dimethylamino)propyl]-1-(4-ethoxy-3-methoxyphenyl)-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione |
| Molecular Weight: | 470.95 |
| Molecular Formula: | C25 H27 Cl N2 O5 |
| Smiles: | [H]C([H])(CCN(C)C)N1C(C2=C(C1=O)Oc1ccc(cc1C2=O)[Cl])c1ccc(c(c1)OC)OCC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4932 |
| logD: | 1.5445 |
| logSw: | -4.1547 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 55.689 |
| InChI Key: | STZVWMYRCRDPCL-JOCHJYFZSA-N |