1-(3-chlorophenyl)-2-[3-(morpholin-4-yl)propyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Chemical Structure Depiction of
1-(3-chlorophenyl)-2-[3-(morpholin-4-yl)propyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
1-(3-chlorophenyl)-2-[3-(morpholin-4-yl)propyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Compound characteristics
| Compound ID: | D658-0230 |
| Compound Name: | 1-(3-chlorophenyl)-2-[3-(morpholin-4-yl)propyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione |
| Molecular Weight: | 438.91 |
| Molecular Formula: | C24 H23 Cl N2 O4 |
| Smiles: | [H]C([H])(CCN1CCOCC1)N1C(C2=C(C1=O)Oc1ccccc1C2=O)c1cccc(c1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2588 |
| logD: | 3.0853 |
| logSw: | -3.7977 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 48.602 |
| InChI Key: | RAZQWDWTVSGIHY-OAQYLSRUSA-N |