2-[3-(morpholin-4-yl)propyl]-1-[3-(pentyloxy)phenyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Chemical Structure Depiction of
2-[3-(morpholin-4-yl)propyl]-1-[3-(pentyloxy)phenyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
2-[3-(morpholin-4-yl)propyl]-1-[3-(pentyloxy)phenyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Compound characteristics
| Compound ID: | D658-0236 |
| Compound Name: | 2-[3-(morpholin-4-yl)propyl]-1-[3-(pentyloxy)phenyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione |
| Molecular Weight: | 490.6 |
| Molecular Formula: | C29 H34 N2 O5 |
| Smiles: | [H]C([H])(CCN1CCOCC1)N1C(C2=C(C1=O)Oc1ccccc1C2=O)c1cccc(c1)OCCCCC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6771 |
| logD: | 4.5036 |
| logSw: | -4.3969 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.02 |
| InChI Key: | PBUAPOQZBDCAEZ-AREMUKBSSA-N |