2-[3-(dimethylamino)propyl]-1-(3-ethoxy-4-propoxyphenyl)-6,7-dimethyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Chemical Structure Depiction of
2-[3-(dimethylamino)propyl]-1-(3-ethoxy-4-propoxyphenyl)-6,7-dimethyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
2-[3-(dimethylamino)propyl]-1-(3-ethoxy-4-propoxyphenyl)-6,7-dimethyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Compound characteristics
| Compound ID: | D658-0395 |
| Compound Name: | 2-[3-(dimethylamino)propyl]-1-(3-ethoxy-4-propoxyphenyl)-6,7-dimethyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione |
| Molecular Weight: | 492.62 |
| Molecular Formula: | C29 H36 N2 O5 |
| Smiles: | [H]C([H])(CCN(C)C)N1C(C2=C(C1=O)Oc1cc(C)c(C)cc1C2=O)c1ccc(c(c1)OCC)OCCC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7564 |
| logD: | 2.8076 |
| logSw: | -4.4485 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 55.563 |
| InChI Key: | PKNPZXZGNZRXFK-AREMUKBSSA-N |