N-({3-methoxy-4-[(1-phenyl-1H-tetrazol-5-yl)oxy]phenyl}methyl)butan-2-amine--hydrogen chloride (1/1)
Chemical Structure Depiction of
N-({3-methoxy-4-[(1-phenyl-1H-tetrazol-5-yl)oxy]phenyl}methyl)butan-2-amine--hydrogen chloride (1/1)
N-({3-methoxy-4-[(1-phenyl-1H-tetrazol-5-yl)oxy]phenyl}methyl)butan-2-amine--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | D661-0015 |
| Compound Name: | N-({3-methoxy-4-[(1-phenyl-1H-tetrazol-5-yl)oxy]phenyl}methyl)butan-2-amine--hydrogen chloride (1/1) |
| Molecular Weight: | 389.88 |
| Molecular Formula: | C19 H23 N5 O2 |
| Salt: | HCl |
| Smiles: | CCC(C)NCc1ccc(c(c1)OC)Oc1nnnn1c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9892 |
| logD: | -1.0641 |
| logSw: | -3.243 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.613 |
| InChI Key: | FYJLSYQMUHETTO-AWEZNQCLSA-N |