N-{[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl}-2-(prop-2-en-1-yl)-2H-tetrazol-5-amine
Chemical Structure Depiction of
N-{[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl}-2-(prop-2-en-1-yl)-2H-tetrazol-5-amine
N-{[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl}-2-(prop-2-en-1-yl)-2H-tetrazol-5-amine
Compound characteristics
| Compound ID: | D662-0241 |
| Compound Name: | N-{[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl}-2-(prop-2-en-1-yl)-2H-tetrazol-5-amine |
| Molecular Weight: | 345.79 |
| Molecular Formula: | C16 H16 Cl N5 O2 |
| Smiles: | COc1ccc(cc1[Cl])c1ccc(CNc2nnn(CC=C)n2)o1 |
| Stereo: | ACHIRAL |
| logP: | 3.4049 |
| logD: | 3.4049 |
| logSw: | -3.9473 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.432 |
| InChI Key: | BBZXGNFMLIQCMM-UHFFFAOYSA-N |