2-({[5-(2,5-dichlorophenyl)furan-2-yl]methyl}amino)butan-1-ol--hydrogen chloride (1/1)
Chemical Structure Depiction of
2-({[5-(2,5-dichlorophenyl)furan-2-yl]methyl}amino)butan-1-ol--hydrogen chloride (1/1)
2-({[5-(2,5-dichlorophenyl)furan-2-yl]methyl}amino)butan-1-ol--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | D665-0187 |
| Compound Name: | 2-({[5-(2,5-dichlorophenyl)furan-2-yl]methyl}amino)butan-1-ol--hydrogen chloride (1/1) |
| Molecular Weight: | 350.67 |
| Molecular Formula: | C15 H17 Cl2 N O2 |
| Salt: | HCl |
| Smiles: | [H]N(Cc1ccc(c2cc(ccc2[Cl])[Cl])o1)C(CC)CO |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1271 |
| logD: | 3.2407 |
| logSw: | -4.4285 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 36.66 |
| InChI Key: | WHYMIYDTVBPNCA-NSHDSACASA-N |