2-({[5-(4-bromophenyl)furan-2-yl]methyl}amino)butan-1-ol--hydrogen chloride (1/1)
Chemical Structure Depiction of
2-({[5-(4-bromophenyl)furan-2-yl]methyl}amino)butan-1-ol--hydrogen chloride (1/1)
2-({[5-(4-bromophenyl)furan-2-yl]methyl}amino)butan-1-ol--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | D665-0411 |
| Compound Name: | 2-({[5-(4-bromophenyl)furan-2-yl]methyl}amino)butan-1-ol--hydrogen chloride (1/1) |
| Molecular Weight: | 360.68 |
| Molecular Formula: | C15 H18 Br N O2 |
| Salt: | HCl |
| Smiles: | [H]N(Cc1ccc(c2ccc(cc2)[Br])o1)C(CC)CO |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8504 |
| logD: | 2.964 |
| logSw: | -3.9388 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 36.66 |
| InChI Key: | QAEJJZXCARWVSB-ZDUSSCGKSA-N |