N-{[5-(3-chlorophenyl)furan-2-yl]methyl}propan-2-amine--hydrogen chloride (1/1)
Chemical Structure Depiction of
N-{[5-(3-chlorophenyl)furan-2-yl]methyl}propan-2-amine--hydrogen chloride (1/1)
N-{[5-(3-chlorophenyl)furan-2-yl]methyl}propan-2-amine--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | D665-1455 |
| Compound Name: | N-{[5-(3-chlorophenyl)furan-2-yl]methyl}propan-2-amine--hydrogen chloride (1/1) |
| Molecular Weight: | 286.2 |
| Molecular Formula: | C14 H16 Cl N O |
| Salt: | HCl |
| Smiles: | CC(C)NCc1ccc(c2cccc(c2)[Cl])o1 |
| Stereo: | ACHIRAL |
| logP: | 3.8753 |
| logD: | 2.1269 |
| logSw: | -4.2181 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 18.6106 |
| InChI Key: | BIMPHTFFPYZOSW-UHFFFAOYSA-N |