N-ethyl-2-hydroxy-6-oxo-1,6-dihydropyrimidine-5-sulfonamide
Chemical Structure Depiction of
N-ethyl-2-hydroxy-6-oxo-1,6-dihydropyrimidine-5-sulfonamide
N-ethyl-2-hydroxy-6-oxo-1,6-dihydropyrimidine-5-sulfonamide
Compound characteristics
| Compound ID: | D668-0003 |
| Compound Name: | N-ethyl-2-hydroxy-6-oxo-1,6-dihydropyrimidine-5-sulfonamide |
| Molecular Weight: | 219.22 |
| Molecular Formula: | C6 H9 N3 O4 S |
| Smiles: | CCNS(C1=CN=C(NC1=O)O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | -1.4871 |
| logD: | -8.3479 |
| logSw: | -1.7862 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 94.012 |
| InChI Key: | ZHGYRHAPJQRCLO-UHFFFAOYSA-N |