2-[(4-ethylphenoxy)methyl]-5,7-dimethyl-1H-benzimidazole
Chemical Structure Depiction of
2-[(4-ethylphenoxy)methyl]-5,7-dimethyl-1H-benzimidazole
2-[(4-ethylphenoxy)methyl]-5,7-dimethyl-1H-benzimidazole
Compound characteristics
| Compound ID: | D670-0109 |
| Compound Name: | 2-[(4-ethylphenoxy)methyl]-5,7-dimethyl-1H-benzimidazole |
| Molecular Weight: | 280.37 |
| Molecular Formula: | C18 H20 N2 O |
| Smiles: | CCc1ccc(cc1)OCc1nc2cc(C)cc(C)c2[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 5.1407 |
| logD: | 5.1404 |
| logSw: | -5.0462 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.518 |
| InChI Key: | LHZUBJHDHCIHPD-UHFFFAOYSA-N |