2-{3-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]phenoxy}-N-phenylacetamide
Chemical Structure Depiction of
2-{3-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]phenoxy}-N-phenylacetamide
2-{3-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]phenoxy}-N-phenylacetamide
Compound characteristics
| Compound ID: | D674-0081 |
| Compound Name: | 2-{3-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]phenoxy}-N-phenylacetamide |
| Molecular Weight: | 405.84 |
| Molecular Formula: | C22 H16 Cl N3 O3 |
| Smiles: | C(C(Nc1ccccc1)=O)Oc1cccc(c1)c1nc(c2ccccc2[Cl])on1 |
| Stereo: | ACHIRAL |
| logP: | 5.3226 |
| logD: | 5.3226 |
| logSw: | -5.7576 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.021 |
| InChI Key: | ZBHWFOXFCFVKTC-UHFFFAOYSA-N |