2-{3-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]phenoxy}-1-(4-methylpiperidin-1-yl)ethan-1-one
Chemical Structure Depiction of
2-{3-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]phenoxy}-1-(4-methylpiperidin-1-yl)ethan-1-one
2-{3-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]phenoxy}-1-(4-methylpiperidin-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | D674-0138 |
| Compound Name: | 2-{3-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]phenoxy}-1-(4-methylpiperidin-1-yl)ethan-1-one |
| Molecular Weight: | 411.89 |
| Molecular Formula: | C22 H22 Cl N3 O3 |
| Smiles: | CC1CCN(CC1)C(COc1cccc(c1)c1nc(c2ccc(cc2)[Cl])on1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9091 |
| logD: | 4.9091 |
| logSw: | -5.1222 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.264 |
| InChI Key: | MSGFZVAXTRSKNA-UHFFFAOYSA-N |