N-(4-methylphenyl)-2-{3-[5-(2-phenylethenyl)-1,2,4-oxadiazol-3-yl]phenoxy}acetamide
Chemical Structure Depiction of
N-(4-methylphenyl)-2-{3-[5-(2-phenylethenyl)-1,2,4-oxadiazol-3-yl]phenoxy}acetamide
N-(4-methylphenyl)-2-{3-[5-(2-phenylethenyl)-1,2,4-oxadiazol-3-yl]phenoxy}acetamide
Compound characteristics
| Compound ID: | D674-0662 |
| Compound Name: | N-(4-methylphenyl)-2-{3-[5-(2-phenylethenyl)-1,2,4-oxadiazol-3-yl]phenoxy}acetamide |
| Molecular Weight: | 411.46 |
| Molecular Formula: | C25 H21 N3 O3 |
| Smiles: | Cc1ccc(cc1)NC(COc1cccc(c1)c1nc(/C=C/c2ccccc2)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.324 |
| logD: | 6.3239 |
| logSw: | -5.5109 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.687 |
| InChI Key: | POMJBEAPFYCNPN-UHFFFAOYSA-N |