N~5~-(3-methylbutyl)-N~4~-[(2-methylphenyl)methyl]-1H-imidazole-4,5-dicarboxamide
Chemical Structure Depiction of
N~5~-(3-methylbutyl)-N~4~-[(2-methylphenyl)methyl]-1H-imidazole-4,5-dicarboxamide
N~5~-(3-methylbutyl)-N~4~-[(2-methylphenyl)methyl]-1H-imidazole-4,5-dicarboxamide
Compound characteristics
| Compound ID: | D675-0150 |
| Compound Name: | N~5~-(3-methylbutyl)-N~4~-[(2-methylphenyl)methyl]-1H-imidazole-4,5-dicarboxamide |
| Molecular Weight: | 328.41 |
| Molecular Formula: | C18 H24 N4 O2 |
| Smiles: | CC(C)CCNC(c1c(C(NCc2ccccc2C)=O)nc[nH]1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7825 |
| logD: | 2.7765 |
| logSw: | -3.0233 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 71.547 |
| InChI Key: | IBEGUHPINWEXHY-UHFFFAOYSA-N |