(4-chlorophenyl)(4-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}piperazin-1-yl)methanone
Chemical Structure Depiction of
(4-chlorophenyl)(4-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}piperazin-1-yl)methanone
(4-chlorophenyl)(4-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}piperazin-1-yl)methanone
Compound characteristics
| Compound ID: | D676-0137 |
| Compound Name: | (4-chlorophenyl)(4-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}piperazin-1-yl)methanone |
| Molecular Weight: | 400.84 |
| Molecular Formula: | C20 H18 Cl F N4 O2 |
| Smiles: | C1CN(CCN1Cc1nc(c2ccc(cc2)F)on1)C(c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.1086 |
| logD: | 3.1086 |
| logSw: | -3.5693 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 53.095 |
| InChI Key: | KOLIMQJDEAUQGB-UHFFFAOYSA-N |