(4-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}piperazin-1-yl)(3-methylphenyl)methanone
Chemical Structure Depiction of
(4-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}piperazin-1-yl)(3-methylphenyl)methanone
(4-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}piperazin-1-yl)(3-methylphenyl)methanone
Compound characteristics
| Compound ID: | D676-0473 |
| Compound Name: | (4-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}piperazin-1-yl)(3-methylphenyl)methanone |
| Molecular Weight: | 380.42 |
| Molecular Formula: | C21 H21 F N4 O2 |
| Smiles: | Cc1cccc(c1)C(N1CCN(CC1)Cc1nc(c2ccc(cc2)F)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8009 |
| logD: | 2.8009 |
| logSw: | -2.9885 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 53.095 |
| InChI Key: | UFPKBZBUPATWLX-UHFFFAOYSA-N |