cyclohexyl(4-{[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl}piperazin-1-yl)methanone
Chemical Structure Depiction of
cyclohexyl(4-{[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl}piperazin-1-yl)methanone
cyclohexyl(4-{[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl}piperazin-1-yl)methanone
Compound characteristics
| Compound ID: | D676-1233 |
| Compound Name: | cyclohexyl(4-{[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl}piperazin-1-yl)methanone |
| Molecular Weight: | 368.48 |
| Molecular Formula: | C21 H28 N4 O2 |
| Smiles: | Cc1ccc(cc1)c1nc(CN2CCN(CC2)C(C2CCCCC2)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.5326 |
| logD: | 3.5326 |
| logSw: | -3.3353 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 53.287 |
| InChI Key: | NZMPYUZQPUNPSE-UHFFFAOYSA-N |