2-(3-fluorophenyl)-N-{[5-(thiophen-2-yl)-1,2,4-oxadiazol-3-yl]methyl}acetamide
Chemical Structure Depiction of
2-(3-fluorophenyl)-N-{[5-(thiophen-2-yl)-1,2,4-oxadiazol-3-yl]methyl}acetamide
2-(3-fluorophenyl)-N-{[5-(thiophen-2-yl)-1,2,4-oxadiazol-3-yl]methyl}acetamide
Compound characteristics
| Compound ID: | D677-0350 |
| Compound Name: | 2-(3-fluorophenyl)-N-{[5-(thiophen-2-yl)-1,2,4-oxadiazol-3-yl]methyl}acetamide |
| Molecular Weight: | 317.34 |
| Molecular Formula: | C15 H12 F N3 O2 S |
| Smiles: | C(C(NCc1nc(c2cccs2)on1)=O)c1cccc(c1)F |
| Stereo: | ACHIRAL |
| logP: | 2.8069 |
| logD: | 2.8069 |
| logSw: | -3.2861 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.125 |
| InChI Key: | WPIFLEPPCFHXPX-UHFFFAOYSA-N |