2-methoxy-N-{[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl}benzamide
Chemical Structure Depiction of
2-methoxy-N-{[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl}benzamide
2-methoxy-N-{[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl}benzamide
Compound characteristics
| Compound ID: | D678-0250 |
| Compound Name: | 2-methoxy-N-{[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl}benzamide |
| Molecular Weight: | 339.35 |
| Molecular Formula: | C18 H17 N3 O4 |
| Smiles: | COc1ccc(cc1)c1nc(CNC(c2ccccc2OC)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.077 |
| logD: | 3.0769 |
| logSw: | -3.5835 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.494 |
| InChI Key: | MDXSQZZZDCAFLX-UHFFFAOYSA-N |