4-chloro-N-{[5-(2-phenylethyl)-1,2,4-oxadiazol-3-yl]methyl}benzamide
Chemical Structure Depiction of
4-chloro-N-{[5-(2-phenylethyl)-1,2,4-oxadiazol-3-yl]methyl}benzamide
4-chloro-N-{[5-(2-phenylethyl)-1,2,4-oxadiazol-3-yl]methyl}benzamide
Compound characteristics
| Compound ID: | D679-0113 |
| Compound Name: | 4-chloro-N-{[5-(2-phenylethyl)-1,2,4-oxadiazol-3-yl]methyl}benzamide |
| Molecular Weight: | 341.8 |
| Molecular Formula: | C18 H16 Cl N3 O2 |
| Smiles: | C(Cc1nc(CNC(c2ccc(cc2)[Cl])=O)no1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.139 |
| logD: | 4.139 |
| logSw: | -4.6853 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.985 |
| InChI Key: | HBZXHLRDMSDAFC-UHFFFAOYSA-N |