N~2~-butyl-N~4~-ethyl-6-[3-(methylsulfanyl)-1H-1,2,4-triazol-1-yl]-1,3,5-triazine-2,4-diamine
Chemical Structure Depiction of
N~2~-butyl-N~4~-ethyl-6-[3-(methylsulfanyl)-1H-1,2,4-triazol-1-yl]-1,3,5-triazine-2,4-diamine
N~2~-butyl-N~4~-ethyl-6-[3-(methylsulfanyl)-1H-1,2,4-triazol-1-yl]-1,3,5-triazine-2,4-diamine
Compound characteristics
| Compound ID: | D684-0180 |
| Compound Name: | N~2~-butyl-N~4~-ethyl-6-[3-(methylsulfanyl)-1H-1,2,4-triazol-1-yl]-1,3,5-triazine-2,4-diamine |
| Molecular Weight: | 308.41 |
| Molecular Formula: | C12 H20 N8 S |
| Smiles: | CCCCNc1nc(NCC)nc(n1)n1cnc(n1)SC |
| Stereo: | ACHIRAL |
| logP: | 3.4803 |
| logD: | 3.4796 |
| logSw: | -3.715 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.441 |
| InChI Key: | PQEXCOJGPUTLEI-UHFFFAOYSA-N |